tripropyl phosphate


phosphoric acid tripropyl ester; propyl phosphate; tri-n-propyl orthophosphate; tripropyl orthophosphate; tri-n-propyl phosphate; tripropyl phosphate
Links:📏 NIST, 📖 PubMed
CAS RN:[513-08-6]
Formula:C9H21O4P; 224.24 g/mol
InChiKey:RXPQRKFMDQNODS-UHFFFAOYSA-N
SMILES:CCCO[P](=O)(OCCC)OCCC
Molecular structure of tripropyl phosphate
Density:1.005 g/mL
Molar volume:223.1 mL/mol
Refractive index:1.417
Molecular refractive power:56.11 mL/mol
Dielectric constant:10.93
Dipole moment:2.93 D
Boiling point:252 °C
Surface tension:29.46 dyn/cm
Log10 partition octanol / water:1.87
Dimroth ET:40.5

Isomers

dibutyl methyl phosphate
Molecular structure of dibutyl methyl phosphate
diethyl pentyl phosphate
Molecular structure of diethyl pentyl phosphate
triisopropyl phosphate
Molecular structure of triisopropyl phosphate
tripropyl phosphate
Molecular structure of tripropyl phosphate